C18H29BN2O4 — CID 145050747
formamide;(6Z)-6-[(2-methylpropan-2-yl)oxymethylidene]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-imine (PubChem CID 145050747) has the molecular formula C18H29BN2O4 and a molecular weight of 348.25 g/mol. Its IUPAC name is formamide;(6Z)-6-[(2-methylpropan-2-yl)oxymethylidene]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-imine.
| Compound Name | formamide;(6Z)-6-[(2-methylpropan-2-yl)oxymethylidene]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 145050747 |
| Molecular Formula | C18H29BN2O4 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | formamide;(6Z)-6-[(2-methylpropan-2-yl)oxymethylidene]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-imine |
| SMILES | NC=O.[H]/N=C1\C=CC=C(B2OC(C)(C)C(C)(C)O2)\C1=C\OC(C)(C)C |
| InChI | InChI=1S/C17H26BNO3.CH3NO/c1-15(2,3)20-11-12-13(9-8-10-14(12)19)18-21-16(4,5)17(6,7)22-18;2-1-3/h8-11,19H,1-7H3;1H,(H2,2,3)/b12-11-,19-14+; |
| InChIKey | CDIGQOTUXGGJIN-IZWMISQKSA-N |
| XLogP | 2.93 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|