C14H21BN2O2 — CID 145386788
1-N,2-N-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 145386788) has the molecular formula C14H21BN2O2 and a molecular weight of 260.15 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 1-N,2-N-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 145386788 |
| Molecular Formula | C14H21BN2O2 |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 1-N,2-N-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | C/N=C1/C(B2OC(C)(C)C(C)(C)O2)=CC=C/C1=N\C |
| InChI | InChI=1S/C14H21BN2O2/c1-13(2)14(3,4)19-15(18-13)10-8-7-9-11(16-5)12(10)17-6/h7-9H,1-6H3/b16-11+,17-12- |
| InChIKey | NUPRWFQEDASRAR-LZTIWXADSA-N |
| XLogP | 2.26 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|