C9H10N2 — CID 145330530
(6Z)-6-[(ethylideneamino)methylidene]cyclohexa-2,4-dien-1-imine (PubChem CID 145330530) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (6Z)-6-[(ethylideneamino)methylidene]cyclohexa-2,4-dien-1-imine.
| Compound Name | (6Z)-6-[(ethylideneamino)methylidene]cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 145330530 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | (6Z)-6-[(ethylideneamino)methylidene]cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=C\C1=C\N=C\C |
| InChI | InChI=1S/C9H10N2/c1-2-11-7-8-5-3-4-6-9(8)10/h2-7,10H,1H3/b8-7-,10-9+,11-2+ |
| InChIKey | XDJQPERVNGABPN-XBGJDHAPSA-N |
| XLogP | 2.11 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|