C14H26BN2O4+ — CID 145365369
[(Z)-3-imino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]azanium (PubChem CID 145365369) has the molecular formula C14H26BN2O4+ and a molecular weight of 297.18 g/mol. Its IUPAC name is [(Z)-3-imino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]azanium.
| Compound Name | [(Z)-3-imino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]azanium |
|---|---|
| PubChem CID | 145365369 |
| Molecular Formula | C14H26BN2O4+ |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | [(Z)-3-imino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]azanium |
| SMILES | [H]/N=C/C(=C\[NH2+]C(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H25BN2O4/c1-12(2,3)19-11(18)17-9-10(8-16)15-20-13(4,5)14(6,7)21-15/h8-9,16H,1-7H3,(H,17,18)/p+1/b10-9+,16-8+ |
| InChIKey | DGMWTCJKYQKEDQ-JTYUCJLDSA-O |
| XLogP | 1.65 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|