C13H22BNO2 — CID 153334289
4-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-1-imine (PubChem CID 153334289) has the molecular formula C13H22BNO2 and a molecular weight of 235.14 g/mol. Its IUPAC name is 4-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-1-imine.
| Compound Name | 4-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 153334289 |
| Molecular Formula | C13H22BNO2 |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 4-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-1-imine |
| SMILES | [H]/N=C/C(=CCC1CC1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H22BNO2/c1-12(2)13(3,4)17-14(16-12)11(9-15)8-7-10-5-6-10/h8-10,15H,5-7H2,1-4H3/b11-8?,15-9+ |
| InChIKey | IAEBQNLTOOLJQA-JWCIJZKPSA-N |
| XLogP | 2.99 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|