C10H17BF2N2O2 — CID 164572479
(Z)-1,1-difluoro-4-imino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-amine (PubChem CID 164572479) has the molecular formula C10H17BF2N2O2 and a molecular weight of 246.07 g/mol. Its IUPAC name is (Z)-1,1-difluoro-4-imino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-amine.
| Compound Name | (Z)-1,1-difluoro-4-imino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-amine |
|---|---|
| PubChem CID | 164572479 |
| Molecular Formula | C10H17BF2N2O2 |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (Z)-1,1-difluoro-4-imino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-amine |
| SMILES | [H]/N=C/C(B1OC(C)(C)C(C)(C)O1)=C(\N)C(F)F |
| InChI | InChI=1S/C10H17BF2N2O2/c1-9(2)10(3,4)17-11(16-9)6(5-14)7(15)8(12)13/h5,8,14H,15H2,1-4H3/b7-6+,14-5+ |
| InChIKey | KVELJIWSLYKLEX-NNAREESLSA-N |
| XLogP | 1.75 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|