About (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine
(E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine (PubChem CID 170964623) has the molecular formula C4H6F2N2
and a molecular weight of 120.10 g/mol. Its IUPAC name is (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine |
| PubChem CID | 170964623 |
| Molecular Formula | C4H6F2N2 |
| Molecular Weight | 120.10 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine |
| SMILES | [H]/N=C/C(=C\N)C(F)F |
| InChI | InChI=1S/C4H6F2N2/c5-4(6)3(1-7)2-8/h1-2,4,7H,8H2/b3-2+,7-1+ |
| InChIKey | BORVGZNCLCCMHP-JRHKPWRGSA-N |
| XLogP | 0.74 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.10 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine?
The IUPAC name of (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine (CID 170964623) is (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine.
What is the SMILES notation for (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine?
The canonical SMILES for (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine is [H]/N=C/C(=C\N)C(F)F.
What is the InChIKey of (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine?
The InChIKey is BORVGZNCLCCMHP-JRHKPWRGSA-N. The full InChI is InChI=1S/C4H6F2N2/c5-4(6)3(1-7)2-8/h1-2,4,7H,8H2/b3-2+,7-1+.
What are the key properties of (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine?
(E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine has a molecular weight of 120.10 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine is sourced from PubChem (CID 170964623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).