C4H6F2N2 — CID 170964623
(E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine (PubChem CID 170964623) has the molecular formula C4H6F2N2 and a molecular weight of 120.10 g/mol. Its IUPAC name is (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine.
| Compound Name | (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine |
|---|---|
| PubChem CID | 170964623 |
| Molecular Formula | C4H6F2N2 |
| Molecular Weight | 120.10 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | (E)-3,3-difluoro-2-methanimidoylprop-1-en-1-amine |
| SMILES | [H]/N=C/C(=C\N)C(F)F |
| InChI | InChI=1S/C4H6F2N2/c5-4(6)3(1-7)2-8/h1-2,4,7H,8H2/b3-2+,7-1+ |
| InChIKey | BORVGZNCLCCMHP-JRHKPWRGSA-N |
| XLogP | 0.74 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.10 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|