C4H7FN2 — CID 171535036
3-fluorobutane-1,2-diimine (PubChem CID 171535036) has the molecular formula C4H7FN2 and a molecular weight of 102.11 g/mol. Its IUPAC name is 3-fluorobutane-1,2-diimine.
| Compound Name | 3-fluorobutane-1,2-diimine |
|---|---|
| PubChem CID | 171535036 |
| Molecular Formula | C4H7FN2 |
| Molecular Weight | 102.11 g/mol |
| Exact Mass | 102.06 |
| IUPAC Name | 3-fluorobutane-1,2-diimine |
| SMILES | [H]/N=C(/C=N/[H])C(C)F |
| InChI | InChI=1S/C4H7FN2/c1-3(5)4(7)2-6/h2-3,6-7H,1H3/b6-2+,7-4- |
| InChIKey | MUXBFYZQJNJSCE-HVAWZRNZSA-N |
| XLogP | 1.01 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.11 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|