C6H12N2 — CID 123957798
1-N,3-dimethylbutane-1,2-diimine (PubChem CID 123957798) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 1-N,3-dimethylbutane-1,2-diimine.
| Compound Name | 1-N,3-dimethylbutane-1,2-diimine |
|---|---|
| PubChem CID | 123957798 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1-N,3-dimethylbutane-1,2-diimine |
| SMILES | [H]/N=C(/C=N/C)C(C)C |
| InChI | InChI=1S/C6H12N2/c1-5(2)6(7)4-8-3/h4-5,7H,1-3H3/b7-6-,8-4+ |
| InChIKey | HVHFCKALIRQMID-AKAREZBESA-N |
| XLogP | 1.36 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|