C6H12N2 — CID 139890655
3-methylpentane-1,2-diimine (PubChem CID 139890655) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 3-methylpentane-1,2-diimine.
| Compound Name | 3-methylpentane-1,2-diimine |
|---|---|
| PubChem CID | 139890655 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 3-methylpentane-1,2-diimine |
| SMILES | [H]/N=C/C(=N/[H])C(C)CC |
| InChI | InChI=1S/C6H12N2/c1-3-5(2)6(8)4-7/h4-5,7-8H,3H2,1-2H3/b7-4+,8-6- |
| InChIKey | ZXFSQDGSSTULGA-MTCKZIEXSA-N |
| XLogP | 1.70 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|