About 4-methyl-2,3-dimethylidenehexan-1-imine
4-methyl-2,3-dimethylidenehexan-1-imine (PubChem CID 170635680) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 4-methyl-2,3-dimethylidenehexan-1-imine.
Molecular Properties
| Compound Name | 4-methyl-2,3-dimethylidenehexan-1-imine |
| PubChem CID | 170635680 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 4-methyl-2,3-dimethylidenehexan-1-imine |
| SMILES | [H]/N=C/C(=C)C(=C)C(C)CC |
| InChI | InChI=1S/C9H15N/c1-5-7(2)9(4)8(3)6-10/h6-7,10H,3-5H2,1-2H3/b10-6+ |
| InChIKey | XJDMEJKDAUHJFT-UXBLZVDNSA-N |
| XLogP | 2.79 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,3-dimethylidenehexan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dimethylidenehexan-1-imine?
The IUPAC name of 4-methyl-2,3-dimethylidenehexan-1-imine (CID 170635680) is 4-methyl-2,3-dimethylidenehexan-1-imine.
What is the SMILES notation for 4-methyl-2,3-dimethylidenehexan-1-imine?
The canonical SMILES for 4-methyl-2,3-dimethylidenehexan-1-imine is [H]/N=C/C(=C)C(=C)C(C)CC.
What is the InChIKey of 4-methyl-2,3-dimethylidenehexan-1-imine?
The InChIKey is XJDMEJKDAUHJFT-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H15N/c1-5-7(2)9(4)8(3)6-10/h6-7,10H,3-5H2,1-2H3/b10-6+.
What are the key properties of 4-methyl-2,3-dimethylidenehexan-1-imine?
4-methyl-2,3-dimethylidenehexan-1-imine has a molecular weight of 137.23 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dimethylidenehexan-1-imine is sourced from PubChem (CID 170635680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).