C8H15N2P — CID 135278571
(3E)-2-methanimidoyl-N-phosphanylhepta-1,3-dien-3-amine (PubChem CID 135278571) has the molecular formula C8H15N2P and a molecular weight of 170.20 g/mol. Its IUPAC name is (3E)-2-methanimidoyl-N-phosphanylhepta-1,3-dien-3-amine.
| Compound Name | (3E)-2-methanimidoyl-N-phosphanylhepta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 135278571 |
| Molecular Formula | C8H15N2P |
| Molecular Weight | 170.20 g/mol |
| Exact Mass | 170.10 |
| IUPAC Name | (3E)-2-methanimidoyl-N-phosphanylhepta-1,3-dien-3-amine |
| SMILES | [H]/N=C/C(=C)/C(=C\CCC)NP |
| InChI | InChI=1S/C8H15N2P/c1-3-4-5-8(10-11)7(2)6-9/h5-6,9-10H,2-4,11H2,1H3/b8-5+,9-6+ |
| InChIKey | QCIDCIDMHVPOBI-XVYDYJIPSA-N |
| XLogP | 2.26 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|