C7H14N4 — CID 176525862
1-[(E)-1-iminohex-2-en-2-yl]guanidine (PubChem CID 176525862) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is 1-[(E)-1-iminohex-2-en-2-yl]guanidine.
| Compound Name | 1-[(E)-1-iminohex-2-en-2-yl]guanidine |
|---|---|
| PubChem CID | 176525862 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 1-[(E)-1-iminohex-2-en-2-yl]guanidine |
| SMILES | [H]/N=C/C(=C\CCC)N/C(N)=N/[H] |
| InChI | InChI=1S/C7H14N4/c1-2-3-4-6(5-8)11-7(9)10/h4-5,8H,2-3H2,1H3,(H4,9,10,11)/b6-4+,8-5+ |
| InChIKey | ZJAXPPNNYQXPRZ-HLQBBKRNSA-N |
| XLogP | 0.80 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|