C10H17FN2S — CID 145036953
ethyl thiohypofluorite;(3E,5Z)-2-methanimidoylhepta-1,3,5-trien-3-amine (PubChem CID 145036953) has the molecular formula C10H17FN2S and a molecular weight of 216.32 g/mol. Its IUPAC name is ethyl thiohypofluorite;(3E,5Z)-2-methanimidoylhepta-1,3,5-trien-3-amine.
| Compound Name | ethyl thiohypofluorite;(3E,5Z)-2-methanimidoylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145036953 |
| Molecular Formula | C10H17FN2S |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | ethyl thiohypofluorite;(3E,5Z)-2-methanimidoylhepta-1,3,5-trien-3-amine |
| SMILES | CCSF.[H]/N=C/C(=C)/C(N)=C\C=C/C |
| InChI | InChI=1S/C8H12N2.C2H5FS/c1-3-4-5-8(10)7(2)6-9;1-2-4-3/h3-6,9H,2,10H2,1H3;2H2,1H3/b4-3-,8-5+,9-6+; |
| InChIKey | KSYLXPSABAIAOY-NHVGKISOSA-N |
| XLogP | 3.23 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|