C9H13NO — CID 134286835
(2Z,4Z)-2-(1-methoxyethenyl)hexa-2,4-dien-1-imine (PubChem CID 134286835) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (2Z,4Z)-2-(1-methoxyethenyl)hexa-2,4-dien-1-imine.
| Compound Name | (2Z,4Z)-2-(1-methoxyethenyl)hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 134286835 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (2Z,4Z)-2-(1-methoxyethenyl)hexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(=C/C=C\C)C(=C)OC |
| InChI | InChI=1S/C9H13NO/c1-4-5-6-9(7-10)8(2)11-3/h4-7,10H,2H2,1,3H3/b5-4-,9-6-,10-7+ |
| InChIKey | CIUSOZZCXRFQHM-NZPKQRPTSA-N |
| XLogP | 2.30 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|