C9H12N2 — CID 123395606
3-ethenylhepta-3,5-diene-1,2-diimine (PubChem CID 123395606) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 3-ethenylhepta-3,5-diene-1,2-diimine.
| Compound Name | 3-ethenylhepta-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 123395606 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3-ethenylhepta-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C(\C=N\[H])C(C=C)=CC=CC |
| InChI | InChI=1S/C9H12N2/c1-3-5-6-8(4-2)9(11)7-10/h3-7,10-11H,2H2,1H3/b5-3?,8-6?,10-7+,11-9+ |
| InChIKey | FXGPDKGWBCXYPX-RSYREBSQSA-N |
| XLogP | 2.34 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|