C10H14N2 — CID 156548781
(2Z,4E)-2,5-dimethylocta-2,4,7-triene-1,6-diimine (PubChem CID 156548781) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (2Z,4E)-2,5-dimethylocta-2,4,7-triene-1,6-diimine.
| Compound Name | (2Z,4E)-2,5-dimethylocta-2,4,7-triene-1,6-diimine |
|---|---|
| PubChem CID | 156548781 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (2Z,4E)-2,5-dimethylocta-2,4,7-triene-1,6-diimine |
| SMILES | [H]/N=C/C(C)=C\C=C(C)/C(C=C)=N/[H] |
| InChI | InChI=1S/C10H14N2/c1-4-10(12)9(3)6-5-8(2)7-11/h4-7,11-12H,1H2,2-3H3/b8-5-,9-6+,11-7+,12-10+ |
| InChIKey | PPCYARVJZXINSD-FNROMVGHSA-N |
| XLogP | 2.73 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|