C7H14N2 — CID 142083351
ethane;(Z)-2-methylbut-2-ene-1,4-diimine (PubChem CID 142083351) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is ethane;(Z)-2-methylbut-2-ene-1,4-diimine.
| Compound Name | ethane;(Z)-2-methylbut-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 142083351 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | ethane;(Z)-2-methylbut-2-ene-1,4-diimine |
| SMILES | CC.[H]/N=C/C=C(C)\C=N\[H] |
| InChI | InChI=1S/C5H8N2.C2H6/c1-5(4-7)2-3-6;1-2/h2-4,6-7H,1H3;1-2H3/b5-2-,6-3+,7-4+; |
| InChIKey | NYTVXGZXNSAEHB-DPEYYSDJSA-N |
| XLogP | 2.26 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|