C14H23N — CID 143482492
ethane;(2Z,4E,6Z)-2,4,5-trimethylnona-2,4,6,8-tetraen-1-imine (PubChem CID 143482492) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is ethane;(2Z,4E,6Z)-2,4,5-trimethylnona-2,4,6,8-tetraen-1-imine.
| Compound Name | ethane;(2Z,4E,6Z)-2,4,5-trimethylnona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 143482492 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | ethane;(2Z,4E,6Z)-2,4,5-trimethylnona-2,4,6,8-tetraen-1-imine |
| SMILES | CC.[H]/N=C/C(C)=C\C(C)=C(C)\C=C/C=C |
| InChI | InChI=1S/C12H17N.C2H6/c1-5-6-7-11(3)12(4)8-10(2)9-13;1-2/h5-9,13H,1H2,2-4H3;1-2H3/b7-6-,10-8-,12-11+,13-9+; |
| InChIKey | BZXAKRBFWRMXHE-ZTWKQKNMSA-N |
| XLogP | 4.69 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|