C13H25NO2 — CID 142397669
2,3-dimethylbutane-2,3-diol;(2Z)-2,4-dimethylpenta-2,4-dien-1-imine (PubChem CID 142397669) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;(2Z)-2,4-dimethylpenta-2,4-dien-1-imine.
| Compound Name | 2,3-dimethylbutane-2,3-diol;(2Z)-2,4-dimethylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142397669 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;(2Z)-2,4-dimethylpenta-2,4-dien-1-imine |
| SMILES | CC(C)(O)C(C)(C)O.[H]/N=C/C(C)=C\C(=C)C |
| InChI | InChI=1S/C7H11N.C6H14O2/c1-6(2)4-7(3)5-8;1-5(2,7)6(3,4)8/h4-5,8H,1H2,2-3H3;7-8H,1-4H3/b7-4-,8-5+; |
| InChIKey | HWRKTMKRCMYKJB-QMKOBIDDSA-N |
| XLogP | 2.69 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|