C18H31NSi — CID 174108529
(2E,6E,8E)-2,5,5,6-tetramethyl-4-methylidene-8-trimethylsilyldeca-2,6,8-trien-1-imine (PubChem CID 174108529) has the molecular formula C18H31NSi and a molecular weight of 289.54 g/mol. Its IUPAC name is (2E,6E,8E)-2,5,5,6-tetramethyl-4-methylidene-8-trimethylsilyldeca-2,6,8-trien-1-imine.
| Compound Name | (2E,6E,8E)-2,5,5,6-tetramethyl-4-methylidene-8-trimethylsilyldeca-2,6,8-trien-1-imine |
|---|---|
| PubChem CID | 174108529 |
| Molecular Formula | C18H31NSi |
| Molecular Weight | 289.54 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | (2E,6E,8E)-2,5,5,6-tetramethyl-4-methylidene-8-trimethylsilyldeca-2,6,8-trien-1-imine |
| SMILES | [H]/N=C/C(C)=C/C(=C)C(C)(C)/C(C)=C/C(=C\C)[Si](C)(C)C |
| InChI | InChI=1S/C18H31NSi/c1-10-17(20(7,8)9)12-16(4)18(5,6)15(3)11-14(2)13-19/h10-13,19H,3H2,1-2,4-9H3/b14-11+,16-12+,17-10+,19-13+ |
| InChIKey | HEJFQYCARLYOSN-YPLVXHNCSA-N |
| XLogP | 5.93 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|