C10H14N+ — CID 102008019
hydron;(2E,4E,6E)-3-methylnona-2,4,6,8-tetraen-1-imine (PubChem CID 102008019) has the molecular formula C10H14N+ and a molecular weight of 148.23 g/mol. Its IUPAC name is hydron;(2E,4E,6E)-3-methylnona-2,4,6,8-tetraen-1-imine.
| Compound Name | hydron;(2E,4E,6E)-3-methylnona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 102008019 |
| Molecular Formula | C10H14N+ |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | hydron;(2E,4E,6E)-3-methylnona-2,4,6,8-tetraen-1-imine |
| SMILES | [H+].[H]/N=C/C=C(C)/C=C/C=C/C=C |
| InChI | InChI=1S/C10H13N/c1-3-4-5-6-7-10(2)8-9-11/h3-9,11H,1H2,2H3/p+1/b5-4+,7-6+,10-8+,11-9+ |
| InChIKey | ISTDNGYEGSJOIY-WOWCYNHXSA-O |
| XLogP | 2.99 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|