C13H19N3 — CID 143271835
(E)-1-[[(2E,4E)-4-ethenyl-6-iminohexa-2,4-dienylidene]amino]-N,N-dimethylprop-1-en-2-amine (PubChem CID 143271835) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (E)-1-[[(2E,4E)-4-ethenyl-6-iminohexa-2,4-dienylidene]amino]-N,N-dimethylprop-1-en-2-amine.
| Compound Name | (E)-1-[[(2E,4E)-4-ethenyl-6-iminohexa-2,4-dienylidene]amino]-N,N-dimethylprop-1-en-2-amine |
|---|---|
| PubChem CID | 143271835 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (E)-1-[[(2E,4E)-4-ethenyl-6-iminohexa-2,4-dienylidene]amino]-N,N-dimethylprop-1-en-2-amine |
| SMILES | [H]/N=C/C=C(C=C)/C=C/C=N/C=C(\C)N(C)C |
| InChI | InChI=1S/C13H19N3/c1-5-13(8-9-14)7-6-10-15-11-12(2)16(3)4/h5-11,14H,1H2,2-4H3/b7-6+,12-11+,13-8+,14-9+,15-10+ |
| InChIKey | BUSAITJPJSSSNC-RIXDVLLNSA-N |
| XLogP | 2.80 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|