C9H13N — CID 123815278
3-prop-1-en-2-ylhexa-2,4-dien-1-imine (PubChem CID 123815278) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 3-prop-1-en-2-ylhexa-2,4-dien-1-imine.
| Compound Name | 3-prop-1-en-2-ylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123815278 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 3-prop-1-en-2-ylhexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C(C=CC)C(=C)C |
| InChI | InChI=1S/C9H13N/c1-4-5-9(6-7-10)8(2)3/h4-7,10H,2H2,1,3H3/b5-4?,9-6?,10-7+ |
| InChIKey | LNTFKIMYGARFMH-SMWRHNFLSA-N |
| XLogP | 2.71 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|