C13H17N — CID 166803174
(3Z,5E,7E)-N-methyl-6-prop-1-en-2-ylnona-3,5,7-trien-1-yn-3-amine (PubChem CID 166803174) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (3Z,5E,7E)-N-methyl-6-prop-1-en-2-ylnona-3,5,7-trien-1-yn-3-amine.
| Compound Name | (3Z,5E,7E)-N-methyl-6-prop-1-en-2-ylnona-3,5,7-trien-1-yn-3-amine |
|---|---|
| PubChem CID | 166803174 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (3Z,5E,7E)-N-methyl-6-prop-1-en-2-ylnona-3,5,7-trien-1-yn-3-amine |
| SMILES | C#C/C(=C/C=C(\C=C\C)C(=C)C)NC |
| InChI | InChI=1S/C13H17N/c1-6-8-12(11(3)4)9-10-13(7-2)14-5/h2,6,8-10,14H,3H2,1,4-5H3/b8-6+,12-9+,13-10- |
| InChIKey | LKOOTAMDKPJMSG-IQCOFVSKSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|