C8H13NO — CID 174339703
(Z,3E)-3-(methylaminomethylidene)hex-4-en-2-one (PubChem CID 174339703) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (Z,3E)-3-(methylaminomethylidene)hex-4-en-2-one.
| Compound Name | (Z,3E)-3-(methylaminomethylidene)hex-4-en-2-one |
|---|---|
| PubChem CID | 174339703 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (Z,3E)-3-(methylaminomethylidene)hex-4-en-2-one |
| SMILES | C/C=C\C(=C/NC)C(C)=O |
| InChI | InChI=1S/C8H13NO/c1-4-5-8(6-9-3)7(2)10/h4-6,9H,1-3H3/b5-4-,8-6+ |
| InChIKey | WSYDJTRQRFMMEK-GSGSLZOQSA-N |
| XLogP | 1.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|