C10H18N2O — CID 129215903
(Z,3E)-3-[[aminomethyl(ethyl)amino]methylidene]hex-4-en-2-one (PubChem CID 129215903) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (Z,3E)-3-[[aminomethyl(ethyl)amino]methylidene]hex-4-en-2-one.
| Compound Name | (Z,3E)-3-[[aminomethyl(ethyl)amino]methylidene]hex-4-en-2-one |
|---|---|
| PubChem CID | 129215903 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (Z,3E)-3-[[aminomethyl(ethyl)amino]methylidene]hex-4-en-2-one |
| SMILES | C/C=C\C(=C/N(CC)CN)C(C)=O |
| InChI | InChI=1S/C10H18N2O/c1-4-6-10(9(3)13)7-12(5-2)8-11/h4,6-7H,5,8,11H2,1-3H3/b6-4-,10-7+ |
| InChIKey | QFQNBDKVIYKOEL-BSAFSDHNSA-N |
| XLogP | 1.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|