C10H18N2 — CID 170199054
(2Z,4Z,6Z)-4-N,5-N-dimethylocta-2,4,6-triene-4,5-diamine (PubChem CID 170199054) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (2Z,4Z,6Z)-4-N,5-N-dimethylocta-2,4,6-triene-4,5-diamine.
| Compound Name | (2Z,4Z,6Z)-4-N,5-N-dimethylocta-2,4,6-triene-4,5-diamine |
|---|---|
| PubChem CID | 170199054 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (2Z,4Z,6Z)-4-N,5-N-dimethylocta-2,4,6-triene-4,5-diamine |
| SMILES | C/C=C\C(NC)=C(/C=C\C)NC |
| InChI | InChI=1S/C10H18N2/c1-5-7-9(11-3)10(12-4)8-6-2/h5-8,11-12H,1-4H3/b7-5-,8-6-,10-9- |
| InChIKey | JOPOEZFQMLKBPD-HDKJAUSJSA-N |
| XLogP | 1.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|