C6H12N2 — CID 58400962
(Z)-N,N'-dimethylbut-2-enimidamide (PubChem CID 58400962) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (Z)-N,N'-dimethylbut-2-enimidamide.
| Compound Name | (Z)-N,N'-dimethylbut-2-enimidamide |
|---|---|
| PubChem CID | 58400962 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (Z)-N,N'-dimethylbut-2-enimidamide |
| SMILES | C/C=C\C(=N\C)NC |
| InChI | InChI=1S/C6H12N2/c1-4-5-6(7-2)8-3/h4-5H,1-3H3,(H,7,8)/b5-4- |
| InChIKey | SHVFXRHQNVCNFM-PLNGDYQASA-N |
| XLogP | 0.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|