About N-(4-chlorophenyl)-N'-methylbut-2-enimidamide
N-(4-chlorophenyl)-N'-methylbut-2-enimidamide (PubChem CID 123435966) has the molecular formula C11H13ClN2
and a molecular weight of 208.69 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-methylbut-2-enimidamide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-N'-methylbut-2-enimidamide |
| PubChem CID | 123435966 |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-(4-chlorophenyl)-N'-methylbut-2-enimidamide |
| SMILES | CC=C/C(=N\C)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClN2/c1-3-4-11(13-2)14-10-7-5-9(12)6-8-10/h3-8H,1-2H3,(H,13,14) |
| InChIKey | LDSNTTPOKHDHNJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chlorophenyl)-N'-methylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-N'-methylbut-2-enimidamide?
The IUPAC name of N-(4-chlorophenyl)-N'-methylbut-2-enimidamide (CID 123435966) is N-(4-chlorophenyl)-N'-methylbut-2-enimidamide.
What is the SMILES notation for N-(4-chlorophenyl)-N'-methylbut-2-enimidamide?
The canonical SMILES for N-(4-chlorophenyl)-N'-methylbut-2-enimidamide is CC=C/C(=N\C)Nc1ccc(Cl)cc1.
What is the InChIKey of N-(4-chlorophenyl)-N'-methylbut-2-enimidamide?
The InChIKey is LDSNTTPOKHDHNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2/c1-3-4-11(13-2)14-10-7-5-9(12)6-8-10/h3-8H,1-2H3,(H,13,14).
What are the key properties of N-(4-chlorophenyl)-N'-methylbut-2-enimidamide?
N-(4-chlorophenyl)-N'-methylbut-2-enimidamide has a molecular weight of 208.69 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-N'-methylbut-2-enimidamide is sourced from PubChem (CID 123435966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).