C8H10ClN3 — CID 20543496
1-(4-chlorophenyl)-2-methylguanidine (PubChem CID 20543496) has the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-methylguanidine.
| Compound Name | 1-(4-chlorophenyl)-2-methylguanidine |
|---|---|
| PubChem CID | 20543496 |
| Molecular Formula | C8H10ClN3 |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 1-(4-chlorophenyl)-2-methylguanidine |
| SMILES | C/N=C(\N)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H10ClN3/c1-11-8(10)12-7-4-2-6(9)3-5-7/h2-5H,1H3,(H3,10,11,12) |
| InChIKey | HRKXQOBEXVFOTB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|