C13H20ClN5 — CID 154377880
1-[amino-[methyl(propan-2-yl)amino]methylidene]-3-(4-chlorophenyl)-2-methylguanidine (PubChem CID 154377880) has the molecular formula C13H20ClN5 and a molecular weight of 281.79 g/mol. Its IUPAC name is 1-[amino-[methyl(propan-2-yl)amino]methylidene]-3-(4-chlorophenyl)-2-methylguanidine.
| Compound Name | 1-[amino-[methyl(propan-2-yl)amino]methylidene]-3-(4-chlorophenyl)-2-methylguanidine |
|---|---|
| PubChem CID | 154377880 |
| Molecular Formula | C13H20ClN5 |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-[amino-[methyl(propan-2-yl)amino]methylidene]-3-(4-chlorophenyl)-2-methylguanidine |
| SMILES | C/N=C(/N=C(N)N(C)C(C)C)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H20ClN5/c1-9(2)19(4)12(15)18-13(16-3)17-11-7-5-10(14)6-8-11/h5-9H,1-4H3,(H3,15,16,17,18) |
| InChIKey | YKKSTISCMPQWCZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|