C11H16ClN3 — CID 144642215
2-N-(4-chlorophenyl)-3-methylbut-1-ene-1,1,2-triamine (PubChem CID 144642215) has the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 2-N-(4-chlorophenyl)-3-methylbut-1-ene-1,1,2-triamine.
| Compound Name | 2-N-(4-chlorophenyl)-3-methylbut-1-ene-1,1,2-triamine |
|---|---|
| PubChem CID | 144642215 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-N-(4-chlorophenyl)-3-methylbut-1-ene-1,1,2-triamine |
| SMILES | CC(C)C(Nc1ccc(Cl)cc1)=C(N)N |
| InChI | InChI=1S/C11H16ClN3/c1-7(2)10(11(13)14)15-9-5-3-8(12)4-6-9/h3-7,15H,13-14H2,1-2H3 |
| InChIKey | AUJWMWAFSHZCAX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |