C11H15N3O2 — CID 68909409
3-[4-[(N'-methylcarbamimidoyl)amino]phenyl]propanoic acid (PubChem CID 68909409) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-[4-[(N'-methylcarbamimidoyl)amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[(N'-methylcarbamimidoyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68909409 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-[4-[(N'-methylcarbamimidoyl)amino]phenyl]propanoic acid |
| SMILES | C/N=C(\N)Nc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C11H15N3O2/c1-13-11(12)14-9-5-2-8(3-6-9)4-7-10(15)16/h2-3,5-6H,4,7H2,1H3,(H,15,16)(H3,12,13,14) |
| InChIKey | UIAAESBUGSGSJB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|