About 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid
5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid (PubChem CID 68912100) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid.
Molecular Properties
| Compound Name | 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid |
| PubChem CID | 68912100 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid |
| SMILES | C/N=C(\N)Nc1ccc(CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C13H19N3O2/c1-15-13(14)16-11-8-6-10(7-9-11)4-2-3-5-12(17)18/h6-9H,2-5H2,1H3,(H,17,18)(H3,14,15,16) |
| InChIKey | HCARIXRGCWVVDW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid?
The IUPAC name of 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid (CID 68912100) is 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid.
What is the SMILES notation for 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid?
The canonical SMILES for 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid is C/N=C(\N)Nc1ccc(CCCCC(=O)O)cc1.
What is the InChIKey of 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid?
The InChIKey is HCARIXRGCWVVDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-15-13(14)16-11-8-6-10(7-9-11)4-2-3-5-12(17)18/h6-9H,2-5H2,1H3,(H,17,18)(H3,14,15,16).
What are the key properties of 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid?
5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid has a molecular weight of 249.31 g/mol, XLogP of 1.84, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[(N'-methylcarbamimidoyl)amino]phenyl]pentanoic acid is sourced from PubChem (CID 68912100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).