C15H22N2O3 — CID 68943734
4-[4-(butylcarbamoylamino)phenyl]butanoic acid (PubChem CID 68943734) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 4-[4-(butylcarbamoylamino)phenyl]butanoic acid.
| Compound Name | 4-[4-(butylcarbamoylamino)phenyl]butanoic acid |
|---|---|
| PubChem CID | 68943734 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 4-[4-(butylcarbamoylamino)phenyl]butanoic acid |
| SMILES | CCCCNC(=O)Nc1ccc(CCCC(=O)O)cc1 |
| InChI | InChI=1S/C15H22N2O3/c1-2-3-11-16-15(20)17-13-9-7-12(8-10-13)5-4-6-14(18)19/h7-10H,2-6,11H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | OQRIOQGPDKTHQQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|