C11H21N3 — CID 144744633
(Z)-N,N'-dimethyl-4-piperidin-4-ylbut-2-enimidamide (PubChem CID 144744633) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is (Z)-N,N'-dimethyl-4-piperidin-4-ylbut-2-enimidamide.
| Compound Name | (Z)-N,N'-dimethyl-4-piperidin-4-ylbut-2-enimidamide |
|---|---|
| PubChem CID | 144744633 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | (Z)-N,N'-dimethyl-4-piperidin-4-ylbut-2-enimidamide |
| SMILES | C/N=C(/C=C\CC1CCNCC1)NC |
| InChI | InChI=1S/C11H21N3/c1-12-11(13-2)5-3-4-10-6-8-14-9-7-10/h3,5,10,14H,4,6-9H2,1-2H3,(H,12,13)/b5-3- |
| InChIKey | KZLJNRWFUUCJIJ-HYXAFXHYSA-N |
| XLogP | 1.18 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|