C12H22 — CID 143078832
(2Z,4Z,6E)-4,5-dimethylocta-2,4,6-triene;ethane (PubChem CID 143078832) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (2Z,4Z,6E)-4,5-dimethylocta-2,4,6-triene;ethane.
| Compound Name | (2Z,4Z,6E)-4,5-dimethylocta-2,4,6-triene;ethane |
|---|---|
| PubChem CID | 143078832 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (2Z,4Z,6E)-4,5-dimethylocta-2,4,6-triene;ethane |
| SMILES | C/C=C\C(C)=C(C)/C=C/C.CC |
| InChI | InChI=1S/C10H16.C2H6/c1-5-7-9(3)10(4)8-6-2;1-2/h5-8H,1-4H3;1-2H3/b7-5-,8-6+,10-9-; |
| InChIKey | XNWCLUPMWGRCPK-MOBNFEKQSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|