C9H16O — CID 143682411
(3E,5E)-2,4-dimethylhepta-3,5-dien-3-ol (PubChem CID 143682411) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (3E,5E)-2,4-dimethylhepta-3,5-dien-3-ol.
| Compound Name | (3E,5E)-2,4-dimethylhepta-3,5-dien-3-ol |
|---|---|
| PubChem CID | 143682411 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (3E,5E)-2,4-dimethylhepta-3,5-dien-3-ol |
| SMILES | C/C=C/C(C)=C(/O)C(C)C |
| InChI | InChI=1S/C9H16O/c1-5-6-8(4)9(10)7(2)3/h5-7,10H,1-4H3/b6-5+,9-8+ |
| InChIKey | KSSXNJODUCPMCT-HHWLVVFRSA-N |
| XLogP | 3.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|