C9H13NO2 — CID 143769557
(2Z,4E,6Z)-4-methyl-5-nitroocta-2,4,6-triene (PubChem CID 143769557) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (2Z,4E,6Z)-4-methyl-5-nitroocta-2,4,6-triene.
| Compound Name | (2Z,4E,6Z)-4-methyl-5-nitroocta-2,4,6-triene |
|---|---|
| PubChem CID | 143769557 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (2Z,4E,6Z)-4-methyl-5-nitroocta-2,4,6-triene |
| SMILES | C/C=C\C(C)=C(/C=C\C)[N+](=O)[O-] |
| InChI | InChI=1S/C9H13NO2/c1-4-6-8(3)9(7-5-2)10(11)12/h4-7H,1-3H3/b6-4-,7-5-,9-8+ |
| InChIKey | PBWBWPKGDYBFJU-VHIIXJFGSA-N |
| XLogP | 2.69 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|