C9H15NO2 — CID 142929729
ethane;(3E,5Z)-4-nitrohepta-1,3,5-triene (PubChem CID 142929729) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-nitrohepta-1,3,5-triene.
| Compound Name | ethane;(3E,5Z)-4-nitrohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142929729 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | ethane;(3E,5Z)-4-nitrohepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/C)[N+](=O)[O-].CC |
| InChI | InChI=1S/C7H9NO2.C2H6/c1-3-5-7(6-4-2)8(9)10;1-2/h3-6H,1H2,2H3;1-2H3/b6-4-,7-5+; |
| InChIKey | AXKZVPKHHMUJQL-ZMVRXXEHSA-N |
| XLogP | 2.94 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|