C6H9NO2 — CID 171376745
(2Z,4E)-3-nitrohexa-2,4-diene (PubChem CID 171376745) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is (2Z,4E)-3-nitrohexa-2,4-diene.
| Compound Name | (2Z,4E)-3-nitrohexa-2,4-diene |
|---|---|
| PubChem CID | 171376745 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (2Z,4E)-3-nitrohexa-2,4-diene |
| SMILES | C/C=C(/C=C/C)[N+](=O)[O-] |
| InChI | InChI=1S/C6H9NO2/c1-3-5-6(4-2)7(8)9/h3-5H,1-2H3/b5-3+,6-4- |
| InChIKey | SINBVKZZULNDNK-UZNMPDEFSA-N |
| XLogP | 1.74 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|