C7H9ClN2O2 — CID 121279012
(3Z,5Z)-4-chloro-3-nitrohepta-1,3,5-trien-2-amine (PubChem CID 121279012) has the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. Its IUPAC name is (3Z,5Z)-4-chloro-3-nitrohepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5Z)-4-chloro-3-nitrohepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 121279012 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | (3Z,5Z)-4-chloro-3-nitrohepta-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C(=C(Cl)\C=C/C)[N+](=O)[O-] |
| InChI | InChI=1S/C7H9ClN2O2/c1-3-4-6(8)7(5(2)9)10(11)12/h3-4H,2,9H2,1H3/b4-3-,7-6- |
| InChIKey | HZBKKXRTABMXIR-CWWKMNTPSA-N |
| XLogP | 1.76 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|