About (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine
(3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine (PubChem CID 90399160) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine |
| PubChem CID | 90399160 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine |
| SMILES | C=N/C=C(\C(=C)N)[N+](=O)[O-] |
| InChI | InChI=1S/C5H7N3O2/c1-4(6)5(3-7-2)8(9)10/h3H,1-2,6H2/b5-3+ |
| InChIKey | UOYHFBFGOYNZHT-HWKANZROSA-N |
| XLogP | 0.28 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine?
The IUPAC name of (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine (CID 90399160) is (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine.
What is the SMILES notation for (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine?
The canonical SMILES for (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine is C=N/C=C(\C(=C)N)[N+](=O)[O-].
What is the InChIKey of (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine?
The InChIKey is UOYHFBFGOYNZHT-HWKANZROSA-N. The full InChI is InChI=1S/C5H7N3O2/c1-4(6)5(3-7-2)8(9)10/h3H,1-2,6H2/b5-3+.
What are the key properties of (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine?
(3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine has a molecular weight of 141.13 g/mol, XLogP of 0.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-(methylideneamino)-3-nitrobuta-1,3-dien-2-amine is sourced from PubChem (CID 90399160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).