About (3E)-4-nitrohexa-1,3,5-trien-2-amine
(3E)-4-nitrohexa-1,3,5-trien-2-amine (PubChem CID 142104623) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is (3E)-4-nitrohexa-1,3,5-trien-2-amine.
Molecular Properties
| Compound Name | (3E)-4-nitrohexa-1,3,5-trien-2-amine |
| PubChem CID | 142104623 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | (3E)-4-nitrohexa-1,3,5-trien-2-amine |
| SMILES | C=C/C(=C\C(=C)N)[N+](=O)[O-] |
| InChI | InChI=1S/C6H8N2O2/c1-3-6(8(9)10)4-5(2)7/h3-4H,1-2,7H2/b6-4+ |
| InChIKey | XMRLXLRACKOFQU-GQCTYLIASA-N |
| XLogP | 0.81 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4-nitrohexa-1,3,5-trien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-nitrohexa-1,3,5-trien-2-amine?
The IUPAC name of (3E)-4-nitrohexa-1,3,5-trien-2-amine (CID 142104623) is (3E)-4-nitrohexa-1,3,5-trien-2-amine.
What is the SMILES notation for (3E)-4-nitrohexa-1,3,5-trien-2-amine?
The canonical SMILES for (3E)-4-nitrohexa-1,3,5-trien-2-amine is C=C/C(=C\C(=C)N)[N+](=O)[O-].
What is the InChIKey of (3E)-4-nitrohexa-1,3,5-trien-2-amine?
The InChIKey is XMRLXLRACKOFQU-GQCTYLIASA-N. The full InChI is InChI=1S/C6H8N2O2/c1-3-6(8(9)10)4-5(2)7/h3-4H,1-2,7H2/b6-4+.
What are the key properties of (3E)-4-nitrohexa-1,3,5-trien-2-amine?
(3E)-4-nitrohexa-1,3,5-trien-2-amine has a molecular weight of 140.14 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-nitrohexa-1,3,5-trien-2-amine is sourced from PubChem (CID 142104623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).