C11H15NO4 — CID 142182010
(2E,4E,6E)-6-nitro-4-prop-2-enoxyocta-2,4,6-trien-3-ol (PubChem CID 142182010) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is (2E,4E,6E)-6-nitro-4-prop-2-enoxyocta-2,4,6-trien-3-ol.
| Compound Name | (2E,4E,6E)-6-nitro-4-prop-2-enoxyocta-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 142182010 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | (2E,4E,6E)-6-nitro-4-prop-2-enoxyocta-2,4,6-trien-3-ol |
| SMILES | C=CCOC(=C/C(=C\C)[N+](=O)[O-])/C(O)=C\C |
| InChI | InChI=1S/C11H15NO4/c1-4-7-16-11(10(13)6-3)8-9(5-2)12(14)15/h4-6,8,13H,1,7H2,2-3H3/b9-5+,10-6+,11-8+ |
| InChIKey | VMZDAJFVHIGWHJ-CDGLOLIRSA-N |
| XLogP | 2.72 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|