C10H15NO4 — CID 142813071
ethane;(3Z,5E)-2-methylidene-5-nitrohepta-3,5-dienoic acid (PubChem CID 142813071) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is ethane;(3Z,5E)-2-methylidene-5-nitrohepta-3,5-dienoic acid.
| Compound Name | ethane;(3Z,5E)-2-methylidene-5-nitrohepta-3,5-dienoic acid |
|---|---|
| PubChem CID | 142813071 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | ethane;(3Z,5E)-2-methylidene-5-nitrohepta-3,5-dienoic acid |
| SMILES | C=C(/C=C\C(=C/C)[N+](=O)[O-])C(=O)O.CC |
| InChI | InChI=1S/C8H9NO4.C2H6/c1-3-7(9(12)13)5-4-6(2)8(10)11;1-2/h3-5H,2H2,1H3,(H,10,11);1-2H3/b5-4-,7-3+; |
| InChIKey | IHBBUMYFGZKSPR-GJJHOYHHSA-N |
| XLogP | 2.39 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|