C8H15NO3 — CID 142143120
methanol;(2E,4Z)-3-nitrohepta-2,4-diene (PubChem CID 142143120) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is methanol;(2E,4Z)-3-nitrohepta-2,4-diene.
| Compound Name | methanol;(2E,4Z)-3-nitrohepta-2,4-diene |
|---|---|
| PubChem CID | 142143120 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | methanol;(2E,4Z)-3-nitrohepta-2,4-diene |
| SMILES | C/C=C(\C=C/CC)[N+](=O)[O-].CO |
| InChI | InChI=1S/C7H11NO2.CH4O/c1-3-5-6-7(4-2)8(9)10;1-2/h4-6H,3H2,1-2H3;2H,1H3/b6-5-,7-4+; |
| InChIKey | LJTKEXTXBAUWDK-BIFKCLKRSA-N |
| XLogP | 1.74 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|