About ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine
ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine (PubChem CID 143268830) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine.
Molecular Properties
| Compound Name | ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine |
| PubChem CID | 143268830 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine |
| SMILES | C/C=C(\C=C/CN(C)c1cccc2ccccc12)[N+](=O)[O-].C=C |
| InChI | InChI=1S/C17H18N2O2.C2H4/c1-3-15(19(20)21)10-7-13-18(2)17-12-6-9-14-8-4-5-11-16(14)17;1-2/h3-12H,13H2,1-2H3;1-2H2/b10-7-,15-3+; |
| InChIKey | PVYPXURAGNNQOO-YAIFQXRMSA-N |
| XLogP | 4.81 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine?
The IUPAC name of ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine (CID 143268830) is ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine.
What is the SMILES notation for ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine?
The canonical SMILES for ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine is C/C=C(\C=C/CN(C)c1cccc2ccccc12)[N+](=O)[O-].C=C.
What is the InChIKey of ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine?
The InChIKey is PVYPXURAGNNQOO-YAIFQXRMSA-N. The full InChI is InChI=1S/C17H18N2O2.C2H4/c1-3-15(19(20)21)10-7-13-18(2)17-12-6-9-14-8-4-5-11-16(14)17;1-2/h3-12H,13H2,1-2H3;1-2H2/b10-7-,15-3+;.
What are the key properties of ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine?
ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine has a molecular weight of 310.40 g/mol, XLogP of 4.81, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;N-methyl-N-[(2Z,4E)-4-nitrohexa-2,4-dienyl]naphthalen-1-amine is sourced from PubChem (CID 143268830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).