C12H14NO3P — CID 19024142
[methyl(naphthalen-1-yl)amino]methylphosphonic acid (PubChem CID 19024142) has the molecular formula C12H14NO3P and a molecular weight of 251.22 g/mol. Its IUPAC name is [methyl(naphthalen-1-yl)amino]methylphosphonic acid.
| Compound Name | [methyl(naphthalen-1-yl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 19024142 |
| Molecular Formula | C12H14NO3P |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | [methyl(naphthalen-1-yl)amino]methylphosphonic acid |
| SMILES | CN(CP(=O)(O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C12H14NO3P/c1-13(9-17(14,15)16)12-8-4-6-10-5-2-3-7-11(10)12/h2-8H,9H2,1H3,(H2,14,15,16) |
| InChIKey | WGYWGOXAOWTSON-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|